C13H22ClN5O2 — CID 114447048
4-chloro-2-[2-(dimethylamino)ethyl]-5-(morpholin-2-ylmethylamino)pyridazin-3-one (PubChem CID 114447048) has the molecular formula C13H22ClN5O2 and a molecular weight of 315.81 g/mol. Its IUPAC name is 4-chloro-2-[2-(dimethylamino)ethyl]-5-(morpholin-2-ylmethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-(morpholin-2-ylmethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114447048 |
| Molecular Formula | C13H22ClN5O2 |
| Molecular Weight | 315.81 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-(morpholin-2-ylmethylamino)pyridazin-3-one |
| SMILES | CN(C)CCn1ncc(NCC2CNCCO2)c(Cl)c1=O |
| InChI | InChI=1S/C13H22ClN5O2/c1-18(2)4-5-19-13(20)12(14)11(9-17-19)16-8-10-7-15-3-6-21-10/h9-10,15-16H,3-8H2,1-2H3 |
| InChIKey | PKHKSGLPBFHMID-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.81 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |