C9H5ClF3N3OS — CID 114449804
4-chloro-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]aniline (PubChem CID 114449804) has the molecular formula C9H5ClF3N3OS and a molecular weight of 295.67 g/mol. Its IUPAC name is 4-chloro-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]aniline.
| Compound Name | 4-chloro-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]aniline |
|---|---|
| PubChem CID | 114449804 |
| Molecular Formula | C9H5ClF3N3OS |
| Molecular Weight | 295.67 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 4-chloro-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy]aniline |
| SMILES | Nc1ccc(Cl)cc1Oc1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H5ClF3N3OS/c10-4-1-2-5(14)6(3-4)17-8-16-15-7(18-8)9(11,12)13/h1-3H,14H2 |
| InChIKey | XJCZHSGTVGJBFD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|