C9H11BrF3N3S — CID 114450324
2-[2-(bromomethyl)piperidin-1-yl]-5-(trifluoromethyl)-1,3,4-thiadiazole (PubChem CID 114450324) has the molecular formula C9H11BrF3N3S and a molecular weight of 330.17 g/mol. Its IUPAC name is 2-[2-(bromomethyl)piperidin-1-yl]-5-(trifluoromethyl)-1,3,4-thiadiazole.
| Compound Name | 2-[2-(bromomethyl)piperidin-1-yl]-5-(trifluoromethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 114450324 |
| Molecular Formula | C9H11BrF3N3S |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 2-[2-(bromomethyl)piperidin-1-yl]-5-(trifluoromethyl)-1,3,4-thiadiazole |
| SMILES | FC(F)(F)c1nnc(N2CCCCC2CBr)s1 |
| InChI | InChI=1S/C9H11BrF3N3S/c10-5-6-3-1-2-4-16(6)8-15-14-7(17-8)9(11,12)13/h6H,1-5H2 |
| InChIKey | BZEMBTPYFLRZSW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|