C9H14BrN3S — CID 116638780
5-[2-(bromomethyl)azepan-1-yl]-1,2,4-thiadiazole (PubChem CID 116638780) has the molecular formula C9H14BrN3S and a molecular weight of 276.20 g/mol. Its IUPAC name is 5-[2-(bromomethyl)azepan-1-yl]-1,2,4-thiadiazole.
| Compound Name | 5-[2-(bromomethyl)azepan-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 116638780 |
| Molecular Formula | C9H14BrN3S |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 5-[2-(bromomethyl)azepan-1-yl]-1,2,4-thiadiazole |
| SMILES | BrCC1CCCCCN1c1ncns1 |
| InChI | InChI=1S/C9H14BrN3S/c10-6-8-4-2-1-3-5-13(8)9-11-7-12-14-9/h7-8H,1-6H2 |
| InChIKey | GAHMHIYXHICFLK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|