C10H16BrN3S — CID 164645088
5-[2-(1-bromopropan-2-yl)piperidin-1-yl]-1,2,4-thiadiazole (PubChem CID 164645088) has the molecular formula C10H16BrN3S and a molecular weight of 290.23 g/mol. Its IUPAC name is 5-[2-(1-bromopropan-2-yl)piperidin-1-yl]-1,2,4-thiadiazole.
| Compound Name | 5-[2-(1-bromopropan-2-yl)piperidin-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 164645088 |
| Molecular Formula | C10H16BrN3S |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 5-[2-(1-bromopropan-2-yl)piperidin-1-yl]-1,2,4-thiadiazole |
| SMILES | CC(CBr)C1CCCCN1c1ncns1 |
| InChI | InChI=1S/C10H16BrN3S/c1-8(6-11)9-4-2-3-5-14(9)10-12-7-13-15-10/h7-9H,2-6H2,1H3 |
| InChIKey | ORJFEUHYVGGTLN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|