C13H14ClN3S — CID 166278684
5-[2-(3-chlorophenyl)piperidin-1-yl]-1,2,4-thiadiazole (PubChem CID 166278684) has the molecular formula C13H14ClN3S and a molecular weight of 279.80 g/mol. Its IUPAC name is 5-[2-(3-chlorophenyl)piperidin-1-yl]-1,2,4-thiadiazole.
| Compound Name | 5-[2-(3-chlorophenyl)piperidin-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 166278684 |
| Molecular Formula | C13H14ClN3S |
| Molecular Weight | 279.80 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5-[2-(3-chlorophenyl)piperidin-1-yl]-1,2,4-thiadiazole |
| SMILES | Clc1cccc(C2CCCCN2c2ncns2)c1 |
| InChI | InChI=1S/C13H14ClN3S/c14-11-5-3-4-10(8-11)12-6-1-2-7-17(12)13-15-9-16-18-13/h3-5,8-9,12H,1-2,6-7H2 |
| InChIKey | NIVLEYBQKWJPSI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.80 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |