C16H29NO4 — CID 114450539
methyl 4-[1-(2-methylbutan-2-ylamino)-1-oxopropan-2-yl]oxycyclohexane-1-carboxylate (PubChem CID 114450539) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is methyl 4-[1-(2-methylbutan-2-ylamino)-1-oxopropan-2-yl]oxycyclohexane-1-carboxylate.
| Compound Name | methyl 4-[1-(2-methylbutan-2-ylamino)-1-oxopropan-2-yl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 114450539 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | methyl 4-[1-(2-methylbutan-2-ylamino)-1-oxopropan-2-yl]oxycyclohexane-1-carboxylate |
| SMILES | CCC(C)(C)NC(=O)C(C)OC1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C16H29NO4/c1-6-16(3,4)17-14(18)11(2)21-13-9-7-12(8-10-13)15(19)20-5/h11-13H,6-10H2,1-5H3,(H,17,18) |
| InChIKey | BQLSDWRCQPGOCA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |