C13H24O4 — CID 114491375
methyl 4-(2-hydroxy-2-methylbutoxy)cyclohexane-1-carboxylate (PubChem CID 114491375) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is methyl 4-(2-hydroxy-2-methylbutoxy)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(2-hydroxy-2-methylbutoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 114491375 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | methyl 4-(2-hydroxy-2-methylbutoxy)cyclohexane-1-carboxylate |
| SMILES | CCC(C)(O)COC1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C13H24O4/c1-4-13(2,15)9-17-11-7-5-10(6-8-11)12(14)16-3/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | QNCSLHHFVUUHNK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |