C33H38ClN7O5S — CID 11445329
tert-butyl 4-[2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]phenyl]sulfanylacetyl]piperazine-1-carboxylate (PubChem CID 11445329) has the molecular formula C33H38ClN7O5S and a molecular weight of 680.23 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]phenyl]sulfanylacetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]phenyl]sulfanylacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11445329 |
| Molecular Formula | C33H38ClN7O5S |
| Molecular Weight | 680.23 g/mol |
| Exact Mass | 679.23 |
| IUPAC Name | tert-butyl 4-[2-[3-[(5-chloro-2-pyridinyl)carbamoyl]-4-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]phenyl]sulfanylacetyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(SCC(=O)N3CCN(C(=O)OC(C)(C)C)CC3)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C33H38ClN7O5S/c1-33(2,3)46-32(45)41-16-14-40(15-17-41)28(42)20-47-24-11-12-26(25(18-24)31(44)38-27-13-10-23(34)19-36-27)37-30(43)22-8-6-21(7-9-22)29(35)39(4)5/h6-13,18-19,35H,14-17,20H2,1-5H3,(H,37,43)(H,36,38,44)/b35-29- |
| InChIKey | UMLCYUBVXFSOET-MJPNWULPSA-N |
| XLogP | 5.30 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.23 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|