C16H26ClFN2 — CID 114453335
1-(3-chloro-5-fluorophenyl)-N-pentyl-N-propan-2-ylethane-1,2-diamine (PubChem CID 114453335) has the molecular formula C16H26ClFN2 and a molecular weight of 300.85 g/mol. Its IUPAC name is 1-(3-chloro-5-fluorophenyl)-N-pentyl-N-propan-2-ylethane-1,2-diamine.
| Compound Name | 1-(3-chloro-5-fluorophenyl)-N-pentyl-N-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 114453335 |
| Molecular Formula | C16H26ClFN2 |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-(3-chloro-5-fluorophenyl)-N-pentyl-N-propan-2-ylethane-1,2-diamine |
| SMILES | CCCCCN(C(C)C)C(CN)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C16H26ClFN2/c1-4-5-6-7-20(12(2)3)16(11-19)13-8-14(17)10-15(18)9-13/h8-10,12,16H,4-7,11,19H2,1-3H3 |
| InChIKey | BOWJFSSCAIYFMV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|