C14H25ClN2S — CID 55002445
1-(5-chlorothiophen-2-yl)-N-pentyl-N-propan-2-ylethane-1,2-diamine (PubChem CID 55002445) has the molecular formula C14H25ClN2S and a molecular weight of 288.89 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-pentyl-N-propan-2-ylethane-1,2-diamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-pentyl-N-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 55002445 |
| Molecular Formula | C14H25ClN2S |
| Molecular Weight | 288.89 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-pentyl-N-propan-2-ylethane-1,2-diamine |
| SMILES | CCCCCN(C(C)C)C(CN)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H25ClN2S/c1-4-5-6-9-17(11(2)3)12(10-16)13-7-8-14(15)18-13/h7-8,11-12H,4-6,9-10,16H2,1-3H3 |
| InChIKey | CEFPZFRJSRXTDM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.89 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|