C13H24N2S — CID 43294656
N-methyl-1-(5-methylthiophen-2-yl)-N-pentylethane-1,2-diamine (PubChem CID 43294656) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is N-methyl-1-(5-methylthiophen-2-yl)-N-pentylethane-1,2-diamine.
| Compound Name | N-methyl-1-(5-methylthiophen-2-yl)-N-pentylethane-1,2-diamine |
|---|---|
| PubChem CID | 43294656 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | N-methyl-1-(5-methylthiophen-2-yl)-N-pentylethane-1,2-diamine |
| SMILES | CCCCCN(C)C(CN)c1ccc(C)s1 |
| InChI | InChI=1S/C13H24N2S/c1-4-5-6-9-15(3)12(10-14)13-8-7-11(2)16-13/h7-8,12H,4-6,9-10,14H2,1-3H3 |
| InChIKey | NFTSUCWOBQTMGQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|