C14H20ClFN2 — CID 114453815
1-[(3-chloro-5-fluorophenyl)methyl]-3-ethylpiperidin-4-amine (PubChem CID 114453815) has the molecular formula C14H20ClFN2 and a molecular weight of 270.78 g/mol. Its IUPAC name is 1-[(3-chloro-5-fluorophenyl)methyl]-3-ethylpiperidin-4-amine.
| Compound Name | 1-[(3-chloro-5-fluorophenyl)methyl]-3-ethylpiperidin-4-amine |
|---|---|
| PubChem CID | 114453815 |
| Molecular Formula | C14H20ClFN2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-[(3-chloro-5-fluorophenyl)methyl]-3-ethylpiperidin-4-amine |
| SMILES | CCC1CN(Cc2cc(F)cc(Cl)c2)CCC1N |
| InChI | InChI=1S/C14H20ClFN2/c1-2-11-9-18(4-3-14(11)17)8-10-5-12(15)7-13(16)6-10/h5-7,11,14H,2-4,8-9,17H2,1H3 |
| InChIKey | WISRBDLCMBQCNZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |