C10H5ClFNO3 — CID 114453827
3-(3-chloro-5-fluorophenyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 114453827) has the molecular formula C10H5ClFNO3 and a molecular weight of 241.60 g/mol. Its IUPAC name is 3-(3-chloro-5-fluorophenyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(3-chloro-5-fluorophenyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 114453827 |
| Molecular Formula | C10H5ClFNO3 |
| Molecular Weight | 241.60 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 3-(3-chloro-5-fluorophenyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(F)cc(Cl)c2)no1 |
| InChI | InChI=1S/C10H5ClFNO3/c11-6-1-5(2-7(12)3-6)8-4-9(10(14)15)16-13-8/h1-4H,(H,14,15) |
| InChIKey | HLOCVVGUYVNWDN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |