About (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone
(7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone (PubChem CID 114455722) has the molecular formula C16H22N2O
and a molecular weight of 258.36 g/mol. Its IUPAC name is (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone.
Molecular Properties
| Compound Name | (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone |
| PubChem CID | 114455722 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone |
| SMILES | CCC1(C(=O)N2CCc3cccc(N)c32)CCCC1 |
| InChI | InChI=1S/C16H22N2O/c1-2-16(9-3-4-10-16)15(19)18-11-8-12-6-5-7-13(17)14(12)18/h5-7H,2-4,8-11,17H2,1H3 |
| InChIKey | VINCKYPMKDFKDC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone?
The IUPAC name of (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone (CID 114455722) is (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone.
What is the SMILES notation for (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone?
The canonical SMILES for (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone is CCC1(C(=O)N2CCc3cccc(N)c32)CCCC1.
What is the InChIKey of (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone?
The InChIKey is VINCKYPMKDFKDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O/c1-2-16(9-3-4-10-16)15(19)18-11-8-12-6-5-7-13(17)14(12)18/h5-7H,2-4,8-11,17H2,1H3.
What are the key properties of (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone?
(7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone has a molecular weight of 258.36 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-amino-2,3-dihydroindol-1-yl)-(1-ethylcyclopentyl)methanone is sourced from PubChem (CID 114455722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).