C12H16N2O2S — CID 114455986
1-(cyclopropylmethylsulfonyl)-2,3-dihydroindol-7-amine (PubChem CID 114455986) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-(cyclopropylmethylsulfonyl)-2,3-dihydroindol-7-amine.
| Compound Name | 1-(cyclopropylmethylsulfonyl)-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114455986 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-(cyclopropylmethylsulfonyl)-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(S(=O)(=O)CC1CC1)CC2 |
| InChI | InChI=1S/C12H16N2O2S/c13-11-3-1-2-10-6-7-14(12(10)11)17(15,16)8-9-4-5-9/h1-3,9H,4-8,13H2 |
| InChIKey | ONVPSPVIABXNBL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|