C12H16N2O2 — CID 114456468
3-(7-amino-2,3-dihydroindol-1-yl)-2-methylpropanoic acid (PubChem CID 114456468) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-(7-amino-2,3-dihydroindol-1-yl)-2-methylpropanoic acid.
| Compound Name | 3-(7-amino-2,3-dihydroindol-1-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 114456468 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-(7-amino-2,3-dihydroindol-1-yl)-2-methylpropanoic acid |
| SMILES | CC(CN1CCc2cccc(N)c21)C(=O)O |
| InChI | InChI=1S/C12H16N2O2/c1-8(12(15)16)7-14-6-5-9-3-2-4-10(13)11(9)14/h2-4,8H,5-7,13H2,1H3,(H,15,16) |
| InChIKey | BROJKBZGRRUCDE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|