C12H17N3O — CID 114456689
2-(7-amino-2,3-dihydroindol-1-yl)-N,N-dimethylacetamide (PubChem CID 114456689) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(7-amino-2,3-dihydroindol-1-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(7-amino-2,3-dihydroindol-1-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 114456689 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-(7-amino-2,3-dihydroindol-1-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCc2cccc(N)c21 |
| InChI | InChI=1S/C12H17N3O/c1-14(2)11(16)8-15-7-6-9-4-3-5-10(13)12(9)15/h3-5H,6-8,13H2,1-2H3 |
| InChIKey | ZCNIETXHNFERGH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|