C12H17N3O — CID 61358971
2-(8-amino-3,4-dihydro-2H-quinolin-1-yl)-N-methylacetamide (PubChem CID 61358971) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(8-amino-3,4-dihydro-2H-quinolin-1-yl)-N-methylacetamide.
| Compound Name | 2-(8-amino-3,4-dihydro-2H-quinolin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 61358971 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-(8-amino-3,4-dihydro-2H-quinolin-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)CN1CCCc2cccc(N)c21 |
| InChI | InChI=1S/C12H17N3O/c1-14-11(16)8-15-7-3-5-9-4-2-6-10(13)12(9)15/h2,4,6H,3,5,7-8,13H2,1H3,(H,14,16) |
| InChIKey | HOHWGYUKKKPKAG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|