C15H21N3O3 — CID 114456249
methyl 4-[[2-(7-amino-2,3-dihydroindol-1-yl)acetyl]amino]butanoate (PubChem CID 114456249) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl 4-[[2-(7-amino-2,3-dihydroindol-1-yl)acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-(7-amino-2,3-dihydroindol-1-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 114456249 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | methyl 4-[[2-(7-amino-2,3-dihydroindol-1-yl)acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN1CCc2cccc(N)c21 |
| InChI | InChI=1S/C15H21N3O3/c1-21-14(20)6-3-8-17-13(19)10-18-9-7-11-4-2-5-12(16)15(11)18/h2,4-5H,3,6-10,16H2,1H3,(H,17,19) |
| InChIKey | HTPNDDPRCXTMNK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|