C55H56P2Si — CID 11445751
[1-[2-bis(3,5-dimethylphenyl)phosphanylnaphthalen-1-yl]-4-trimethylsilylnaphthalen-2-yl]-bis(3,5-dimethylphenyl)phosphane (PubChem CID 11445751) has the molecular formula C55H56P2Si and a molecular weight of 807.09 g/mol. Its IUPAC name is [1-[2-bis(3,5-dimethylphenyl)phosphanylnaphthalen-1-yl]-4-trimethylsilylnaphthalen-2-yl]-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [1-[2-bis(3,5-dimethylphenyl)phosphanylnaphthalen-1-yl]-4-trimethylsilylnaphthalen-2-yl]-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 11445751 |
| Molecular Formula | C55H56P2Si |
| Molecular Weight | 807.09 g/mol |
| Exact Mass | 806.36 |
| IUPAC Name | [1-[2-bis(3,5-dimethylphenyl)phosphanylnaphthalen-1-yl]-4-trimethylsilylnaphthalen-2-yl]-bis(3,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)c2ccc3ccccc3c2-c2c(P(c3cc(C)cc(C)c3)c3cc(C)cc(C)c3)cc([Si](C)(C)C)c3ccccc23)c1 |
| InChI | InChI=1S/C55H56P2Si/c1-35-22-36(2)27-44(26-35)56(45-28-37(3)23-38(4)29-45)51-21-20-43-16-12-13-17-48(43)54(51)55-50-19-15-14-18-49(50)53(58(9,10)11)34-52(55)57(46-30-39(5)24-40(6)31-46)47-32-41(7)25-42(8)33-47/h12-34H,1-11H3 |
| InChIKey | WTZMPZJNBYKZCD-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.09 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|