C50H48Cl2P2RuSi2 — CID 11423163
dichlororuthenium;[1-(2-diphenylphosphanyl-4-trimethylsilylnaphthalen-1-yl)-4-trimethylsilylnaphthalen-2-yl]-diphenylphosphane (PubChem CID 11423163) has the molecular formula C50H48Cl2P2RuSi2 and a molecular weight of 939.03 g/mol. Its IUPAC name is dichlororuthenium;[1-(2-diphenylphosphanyl-4-trimethylsilylnaphthalen-1-yl)-4-trimethylsilylnaphthalen-2-yl]-diphenylphosphane.
| Compound Name | dichlororuthenium;[1-(2-diphenylphosphanyl-4-trimethylsilylnaphthalen-1-yl)-4-trimethylsilylnaphthalen-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 11423163 |
| Molecular Formula | C50H48Cl2P2RuSi2 |
| Molecular Weight | 939.03 g/mol |
| Exact Mass | 938.12 |
| IUPAC Name | dichlororuthenium;[1-(2-diphenylphosphanyl-4-trimethylsilylnaphthalen-1-yl)-4-trimethylsilylnaphthalen-2-yl]-diphenylphosphane |
| SMILES | C[Si](C)(C)c1cc(P(c2ccccc2)c2ccccc2)c(-c2c(P(c3ccccc3)c3ccccc3)cc([Si](C)(C)C)c3ccccc23)c2ccccc12.Cl[Ru]Cl |
| InChI | InChI=1S/C50H48P2Si2.2ClH.Ru/c1-53(2,3)47-35-45(51(37-23-11-7-12-24-37)38-25-13-8-14-26-38)49(43-33-21-19-31-41(43)47)50-44-34-22-20-32-42(44)48(54(4,5)6)36-46(50)52(39-27-15-9-16-28-39)40-29-17-10-18-30-40;;;/h7-36H,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | SZNIFJIRDQWIFC-UHFFFAOYSA-L |
| XLogP | 11.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.03 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|