About dichlororuthenium;triphenylphosphane;hydrate
dichlororuthenium;triphenylphosphane;hydrate (PubChem CID 89443339) has the molecular formula C18H17Cl2OPRu
and a molecular weight of 452.28 g/mol. Its IUPAC name is dichlororuthenium;triphenylphosphane;hydrate.
Molecular Properties
| Compound Name | dichlororuthenium;triphenylphosphane;hydrate |
| PubChem CID | 89443339 |
| Molecular Formula | C18H17Cl2OPRu |
| Molecular Weight | 452.28 g/mol |
| Exact Mass | 451.94 |
| IUPAC Name | dichlororuthenium;triphenylphosphane;hydrate |
| SMILES | Cl[Ru]Cl.O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2ClH.H2O.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h1-15H;2*1H;1H2;/q;;;;+2/p-2 |
| InChIKey | MWBWUJLBKBIACS-UHFFFAOYSA-L |
| XLogP | 4.00 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichlororuthenium;triphenylphosphane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlororuthenium;triphenylphosphane;hydrate?
The IUPAC name of dichlororuthenium;triphenylphosphane;hydrate (CID 89443339) is dichlororuthenium;triphenylphosphane;hydrate.
What is the SMILES notation for dichlororuthenium;triphenylphosphane;hydrate?
The canonical SMILES for dichlororuthenium;triphenylphosphane;hydrate is Cl[Ru]Cl.O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dichlororuthenium;triphenylphosphane;hydrate?
The InChIKey is MWBWUJLBKBIACS-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H15P.2ClH.H2O.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h1-15H;2*1H;1H2;/q;;;;+2/p-2.
What are the key properties of dichlororuthenium;triphenylphosphane;hydrate?
dichlororuthenium;triphenylphosphane;hydrate has a molecular weight of 452.28 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlororuthenium;triphenylphosphane;hydrate is sourced from PubChem (CID 89443339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).