C44H30O2P4 — CID 88908059
[1-(2-diphenylphosphanyl-4-phosphorosonaphthalen-1-yl)-4-phosphorosonaphthalen-2-yl]-diphenylphosphane (PubChem CID 88908059) has the molecular formula C44H30O2P4 and a molecular weight of 714.62 g/mol. Its IUPAC name is [1-(2-diphenylphosphanyl-4-phosphorosonaphthalen-1-yl)-4-phosphorosonaphthalen-2-yl]-diphenylphosphane.
| Compound Name | [1-(2-diphenylphosphanyl-4-phosphorosonaphthalen-1-yl)-4-phosphorosonaphthalen-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 88908059 |
| Molecular Formula | C44H30O2P4 |
| Molecular Weight | 714.62 g/mol |
| Exact Mass | 714.12 |
| IUPAC Name | [1-(2-diphenylphosphanyl-4-phosphorosonaphthalen-1-yl)-4-phosphorosonaphthalen-2-yl]-diphenylphosphane |
| SMILES | O=Pc1cc(P(c2ccccc2)c2ccccc2)c(-c2c(P(c3ccccc3)c3ccccc3)cc(P=O)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C44H30O2P4/c45-47-39-29-41(49(31-17-5-1-6-18-31)32-19-7-2-8-20-32)43(37-27-15-13-25-35(37)39)44-38-28-16-14-26-36(38)40(48-46)30-42(44)50(33-21-9-3-10-22-33)34-23-11-4-12-24-34/h1-30H |
| InChIKey | MMNQDZHIXPNPKN-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.62 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|