C13H17ClO4 — CID 114459538
2-chloro-6-(2,2-diethoxyethoxy)benzaldehyde (PubChem CID 114459538) has the molecular formula C13H17ClO4 and a molecular weight of 272.73 g/mol. Its IUPAC name is 2-chloro-6-(2,2-diethoxyethoxy)benzaldehyde.
| Compound Name | 2-chloro-6-(2,2-diethoxyethoxy)benzaldehyde |
|---|---|
| PubChem CID | 114459538 |
| Molecular Formula | C13H17ClO4 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-chloro-6-(2,2-diethoxyethoxy)benzaldehyde |
| SMILES | CCOC(COc1cccc(Cl)c1C=O)OCC |
| InChI | InChI=1S/C13H17ClO4/c1-3-16-13(17-4-2)9-18-12-7-5-6-11(14)10(12)8-15/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | CAGYLQDIELMYGV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|