C18H28N2O — CID 114460064
1-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)cycloheptane-1-carbonitrile (PubChem CID 114460064) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)cycloheptane-1-carbonitrile.
| Compound Name | 1-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)cycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 114460064 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 1-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)cycloheptane-1-carbonitrile |
| SMILES | CC(C)(C)C1=CCN(C(=O)C2(C#N)CCCCCC2)CC1 |
| InChI | InChI=1S/C18H28N2O/c1-17(2,3)15-8-12-20(13-9-15)16(21)18(14-19)10-6-4-5-7-11-18/h8H,4-7,9-13H2,1-3H3 |
| InChIKey | BKJOYSLUUDJYMY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|