C18H28N2O — CID 38029996
2-[(1S,4S,6S)-3-methyl-4-(2-oxo-2-pyrrolidin-1-ylethyl)-6-propan-2-ylcyclohex-2-en-1-yl]acetonitrile (PubChem CID 38029996) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-[(1S,4S,6S)-3-methyl-4-(2-oxo-2-pyrrolidin-1-ylethyl)-6-propan-2-ylcyclohex-2-en-1-yl]acetonitrile.
| Compound Name | 2-[(1S,4S,6S)-3-methyl-4-(2-oxo-2-pyrrolidin-1-ylethyl)-6-propan-2-ylcyclohex-2-en-1-yl]acetonitrile |
|---|---|
| PubChem CID | 38029996 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-[(1S,4S,6S)-3-methyl-4-(2-oxo-2-pyrrolidin-1-ylethyl)-6-propan-2-ylcyclohex-2-en-1-yl]acetonitrile |
| SMILES | CC1=C[C@@H](CC#N)[C@H](C(C)C)C[C@H]1CC(=O)N1CCCC1 |
| InChI | InChI=1S/C18H28N2O/c1-13(2)17-11-16(14(3)10-15(17)6-7-19)12-18(21)20-8-4-5-9-20/h10,13,15-17H,4-6,8-9,11-12H2,1-3H3/t15-,16+,17+/m1/s1 |
| InChIKey | DJDKQZNQUQLNPX-IKGGRYGDSA-N |
| XLogP | 3.77 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|