About N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine
N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine (PubChem CID 114460734) has the molecular formula C17H27N3
and a molecular weight of 273.42 g/mol. Its IUPAC name is N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine |
| PubChem CID | 114460734 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cccc(N2CC=C(C(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C17H27N3/c1-5-18-13-15-7-6-8-16(19-15)20-11-9-14(10-12-20)17(2,3)4/h6-9,18H,5,10-13H2,1-4H3 |
| InChIKey | PCTJKXZDJMVQHN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine?
The IUPAC name of N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine (CID 114460734) is N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine.
What is the SMILES notation for N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine?
The canonical SMILES for N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine is CCNCc1cccc(N2CC=C(C(C)(C)C)CC2)n1.
What is the InChIKey of N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine?
The InChIKey is PCTJKXZDJMVQHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3/c1-5-18-13-15-7-6-8-16(19-15)20-11-9-14(10-12-20)17(2,3)4/h6-9,18H,5,10-13H2,1-4H3.
What are the key properties of N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine?
N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine has a molecular weight of 273.42 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methyl]ethanamine is sourced from PubChem (CID 114460734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).