C8H15NO — CID 11446387
4-ethyl-2-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 11446387) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 4-ethyl-2-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-ethyl-2-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11446387 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 4-ethyl-2-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CCC1COC(C(C)C)=N1 |
| InChI | InChI=1S/C8H15NO/c1-4-7-5-10-8(9-7)6(2)3/h6-7H,4-5H2,1-3H3 |
| InChIKey | VUGWONYYTGDAPF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |