C11H20N2O2 — CID 11020211
(2S)-3,6-diethoxy-2-propan-2-yl-2,5-dihydropyrazine (PubChem CID 11020211) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (2S)-3,6-diethoxy-2-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2S)-3,6-diethoxy-2-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 11020211 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (2S)-3,6-diethoxy-2-propan-2-yl-2,5-dihydropyrazine |
| SMILES | CCOC1=N[C@@H](C(C)C)C(OCC)=NC1 |
| InChI | InChI=1S/C11H20N2O2/c1-5-14-9-7-12-11(15-6-2)10(13-9)8(3)4/h8,10H,5-7H2,1-4H3/t10-/m0/s1 |
| InChIKey | HRAZLOIRFUQOPL-JTQLQIEISA-N |
| XLogP | 1.89 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |