C12H19ClN2OS — CID 114466541
1-(4-chlorothiophen-2-yl)-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine (PubChem CID 114466541) has the molecular formula C12H19ClN2OS and a molecular weight of 274.82 g/mol. Its IUPAC name is 1-(4-chlorothiophen-2-yl)-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine.
| Compound Name | 1-(4-chlorothiophen-2-yl)-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 114466541 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-(4-chlorothiophen-2-yl)-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine |
| SMILES | C=C(C)COCCNC(CN)c1cc(Cl)cs1 |
| InChI | InChI=1S/C12H19ClN2OS/c1-9(2)7-16-4-3-15-11(6-14)12-5-10(13)8-17-12/h5,8,11,15H,1,3-4,6-7,14H2,2H3 |
| InChIKey | LWVQHOLVECCPBY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|