C9H11ClN2S — CID 79426626
1-(4-chlorothiophen-2-yl)-N-prop-2-ynylethane-1,2-diamine (PubChem CID 79426626) has the molecular formula C9H11ClN2S and a molecular weight of 214.72 g/mol. Its IUPAC name is 1-(4-chlorothiophen-2-yl)-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | 1-(4-chlorothiophen-2-yl)-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 79426626 |
| Molecular Formula | C9H11ClN2S |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 1-(4-chlorothiophen-2-yl)-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNC(CN)c1cc(Cl)cs1 |
| InChI | InChI=1S/C9H11ClN2S/c1-2-3-12-8(5-11)9-4-7(10)6-13-9/h1,4,6,8,12H,3,5,11H2 |
| InChIKey | GLWBKUGJFXWGHP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|