About 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine
1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 116699256) has the molecular formula C13H11Cl2F3N2S
and a molecular weight of 355.21 g/mol. Its IUPAC name is 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| PubChem CID | 116699256 |
| Molecular Formula | C13H11Cl2F3N2S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | NCC(Nc1cc(Cl)cc(C(F)(F)F)c1)c1cc(Cl)cs1 |
| InChI | InChI=1S/C13H11Cl2F3N2S/c14-8-1-7(13(16,17)18)2-10(3-8)20-11(5-19)12-4-9(15)6-21-12/h1-4,6,11,20H,5,19H2 |
| InChIKey | GWXGIRQTFBKZOV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine?
The IUPAC name of 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine (CID 116699256) is 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine.
What is the SMILES notation for 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine?
The canonical SMILES for 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine is NCC(Nc1cc(Cl)cc(C(F)(F)F)c1)c1cc(Cl)cs1.
What is the InChIKey of 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine?
The InChIKey is GWXGIRQTFBKZOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2F3N2S/c14-8-1-7(13(16,17)18)2-10(3-8)20-11(5-19)12-4-9(15)6-21-12/h1-4,6,11,20H,5,19H2.
What are the key properties of 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine?
1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine has a molecular weight of 355.21 g/mol, XLogP of 5.19, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorothiophen-2-yl)-N-[3-chloro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine is sourced from PubChem (CID 116699256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).