C11H12ClFN2 — CID 114843243
1-(4-chloro-2-fluorophenyl)-N-prop-2-ynylethane-1,2-diamine (PubChem CID 114843243) has the molecular formula C11H12ClFN2 and a molecular weight of 226.68 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 114843243 |
| Molecular Formula | C11H12ClFN2 |
| Molecular Weight | 226.68 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNC(CN)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H12ClFN2/c1-2-5-15-11(7-14)9-4-3-8(12)6-10(9)13/h1,3-4,6,11,15H,5,7,14H2 |
| InChIKey | FNSBCQZLXGKIEO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.68 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|