C13H28N2O2 — CID 114466700
2-(methoxymethyl)-3-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine (PubChem CID 114466700) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-(methoxymethyl)-3-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine.
| Compound Name | 2-(methoxymethyl)-3-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 114466700 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2-(methoxymethyl)-3-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine |
| SMILES | C=C(C)COCCNC(CN)(COC)C(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-11(2)8-17-7-6-15-13(9-14,10-16-5)12(3)4/h12,15H,1,6-10,14H2,2-5H3 |
| InChIKey | OGJCANCVOOTTEG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|