C10H21NO3S — CID 114466800
2-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]propane-2-sulfonamide (PubChem CID 114466800) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 114466800 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]propane-2-sulfonamide |
| SMILES | C=C(C)COCCNS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C10H21NO3S/c1-9(2)8-14-7-6-11-15(12,13)10(3,4)5/h11H,1,6-8H2,2-5H3 |
| InChIKey | YYAJBYIIIOFNMU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|