C16H33NO4 — CID 114467166
2-[2-(2-butoxyethoxy)ethoxy]-N-[2-(2-methylprop-2-enoxy)ethyl]ethanamine (PubChem CID 114467166) has the molecular formula C16H33NO4 and a molecular weight of 303.44 g/mol. Its IUPAC name is 2-[2-(2-butoxyethoxy)ethoxy]-N-[2-(2-methylprop-2-enoxy)ethyl]ethanamine.
| Compound Name | 2-[2-(2-butoxyethoxy)ethoxy]-N-[2-(2-methylprop-2-enoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 114467166 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 2-[2-(2-butoxyethoxy)ethoxy]-N-[2-(2-methylprop-2-enoxy)ethyl]ethanamine |
| SMILES | C=C(C)COCCNCCOCCOCCOCCCC |
| InChI | InChI=1S/C16H33NO4/c1-4-5-8-18-11-13-20-14-12-19-9-6-17-7-10-21-15-16(2)3/h17H,2,4-15H2,1,3H3 |
| InChIKey | OVKZAGLVFHLTKV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|