C9H17NO4S — CID 114468408
3-(morpholin-2-ylmethoxy)thiolane 1,1-dioxide (PubChem CID 114468408) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-(morpholin-2-ylmethoxy)thiolane 1,1-dioxide.
| Compound Name | 3-(morpholin-2-ylmethoxy)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 114468408 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 3-(morpholin-2-ylmethoxy)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(OCC2CNCCO2)C1 |
| InChI | InChI=1S/C9H17NO4S/c11-15(12)4-1-8(7-15)14-6-9-5-10-2-3-13-9/h8-10H,1-7H2 |
| InChIKey | ZECVJCXFJBKUBF-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |