C10H11N3O2 — CID 11447060
3-[[(E)-pyridin-3-ylmethylideneamino]methyl]-1,3-oxazolidin-2-one (PubChem CID 11447060) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-[[(E)-pyridin-3-ylmethylideneamino]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[[(E)-pyridin-3-ylmethylideneamino]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11447060 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-[[(E)-pyridin-3-ylmethylideneamino]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C/N=C/c1cccnc1 |
| InChI | InChI=1S/C10H11N3O2/c14-10-13(4-5-15-10)8-12-7-9-2-1-3-11-6-9/h1-3,6-7H,4-5,8H2/b12-7+ |
| InChIKey | IEDFOIRFLVWFDE-KPKJPENVSA-N |
| XLogP | 0.91 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|