C10H12N2O3 — CID 114470975
3-(3-methylbut-3-enoxy)pyridazine-4-carboxylic acid (PubChem CID 114470975) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-(3-methylbut-3-enoxy)pyridazine-4-carboxylic acid.
| Compound Name | 3-(3-methylbut-3-enoxy)pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 114470975 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3-(3-methylbut-3-enoxy)pyridazine-4-carboxylic acid |
| SMILES | C=C(C)CCOc1nnccc1C(=O)O |
| InChI | InChI=1S/C10H12N2O3/c1-7(2)4-6-15-9-8(10(13)14)3-5-11-12-9/h3,5H,1,4,6H2,2H3,(H,13,14) |
| InChIKey | RAILDRGNYKMWQH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|