C11H16BrNS — CID 114474798
1-(5-bromothiophen-2-yl)-N,4-dimethylpent-4-en-1-amine (PubChem CID 114474798) has the molecular formula C11H16BrNS and a molecular weight of 274.23 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N,4-dimethylpent-4-en-1-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-N,4-dimethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 114474798 |
| Molecular Formula | C11H16BrNS |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N,4-dimethylpent-4-en-1-amine |
| SMILES | C=C(C)CCC(NC)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H16BrNS/c1-8(2)4-5-9(13-3)10-6-7-11(12)14-10/h6-7,9,13H,1,4-5H2,2-3H3 |
| InChIKey | VUIGBTPFOIOCRK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|