C10H16N2S — CID 114475544
N,4-dimethyl-1-(1,3-thiazol-5-yl)pent-4-en-1-amine (PubChem CID 114475544) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is N,4-dimethyl-1-(1,3-thiazol-5-yl)pent-4-en-1-amine.
| Compound Name | N,4-dimethyl-1-(1,3-thiazol-5-yl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 114475544 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N,4-dimethyl-1-(1,3-thiazol-5-yl)pent-4-en-1-amine |
| SMILES | C=C(C)CCC(NC)c1cncs1 |
| InChI | InChI=1S/C10H16N2S/c1-8(2)4-5-9(11-3)10-6-12-7-13-10/h6-7,9,11H,1,4-5H2,2-3H3 |
| InChIKey | NMJQJICEXOVNHQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|