C14H19NO2 — CID 114474946
1-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methylpent-4-en-1-amine (PubChem CID 114474946) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methylpent-4-en-1-amine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 114474946 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methylpent-4-en-1-amine |
| SMILES | C=C(C)CCC(N)C1COc2ccccc2O1 |
| InChI | InChI=1S/C14H19NO2/c1-10(2)7-8-11(15)14-9-16-12-5-3-4-6-13(12)17-14/h3-6,11,14H,1,7-9,15H2,2H3 |
| InChIKey | LQRUYNUJSNADMN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|