C13H15NO2 — CID 65352505
1-(2,3-dihydro-1,4-benzodioxin-3-yl)pent-4-yn-1-amine (PubChem CID 65352505) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-yl)pent-4-yn-1-amine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-yl)pent-4-yn-1-amine |
|---|---|
| PubChem CID | 65352505 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-yl)pent-4-yn-1-amine |
| SMILES | C#CCCC(N)C1COc2ccccc2O1 |
| InChI | InChI=1S/C13H15NO2/c1-2-3-6-10(14)13-9-15-11-7-4-5-8-12(11)16-13/h1,4-5,7-8,10,13H,3,6,9,14H2 |
| InChIKey | CIKPGSFFWPMOGL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|