C15H20N6 — CID 114476668
2-[4-(5,6-dimethylpyrazin-2-yl)piperazin-1-yl]pyridin-3-amine (PubChem CID 114476668) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 2-[4-(5,6-dimethylpyrazin-2-yl)piperazin-1-yl]pyridin-3-amine.
| Compound Name | 2-[4-(5,6-dimethylpyrazin-2-yl)piperazin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 114476668 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[4-(5,6-dimethylpyrazin-2-yl)piperazin-1-yl]pyridin-3-amine |
| SMILES | Cc1ncc(N2CCN(c3ncccc3N)CC2)nc1C |
| InChI | InChI=1S/C15H20N6/c1-11-12(2)19-14(10-18-11)20-6-8-21(9-7-20)15-13(16)4-3-5-17-15/h3-5,10H,6-9,16H2,1-2H3 |
| InChIKey | XPTYKLYYEKHPSR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |