C13H22O4 — CID 114477820
2-ethoxycarbonyl-5-methyl-2-propan-2-ylhex-5-enoic acid (PubChem CID 114477820) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 2-ethoxycarbonyl-5-methyl-2-propan-2-ylhex-5-enoic acid.
| Compound Name | 2-ethoxycarbonyl-5-methyl-2-propan-2-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 114477820 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-ethoxycarbonyl-5-methyl-2-propan-2-ylhex-5-enoic acid |
| SMILES | C=C(C)CCC(C(=O)O)(C(=O)OCC)C(C)C |
| InChI | InChI=1S/C13H22O4/c1-6-17-12(16)13(10(4)5,11(14)15)8-7-9(2)3/h10H,2,6-8H2,1,3-5H3,(H,14,15) |
| InChIKey | GZUNXESXOCMDLK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|