C14H22O7 — CID 21079453
4-ethoxycarbonyl-4-(2-methylpropanoyl)heptanedioic acid (PubChem CID 21079453) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is 4-ethoxycarbonyl-4-(2-methylpropanoyl)heptanedioic acid.
| Compound Name | 4-ethoxycarbonyl-4-(2-methylpropanoyl)heptanedioic acid |
|---|---|
| PubChem CID | 21079453 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-ethoxycarbonyl-4-(2-methylpropanoyl)heptanedioic acid |
| SMILES | CCOC(=O)C(CCC(=O)O)(CCC(=O)O)C(=O)C(C)C |
| InChI | InChI=1S/C14H22O7/c1-4-21-13(20)14(7-5-10(15)16,8-6-11(17)18)12(19)9(2)3/h9H,4-8H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | DYWCEKIZXDEHKV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|