C10H19NO — CID 114477853
3-amino-2,7-dimethyloct-7-en-4-one (PubChem CID 114477853) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 3-amino-2,7-dimethyloct-7-en-4-one.
| Compound Name | 3-amino-2,7-dimethyloct-7-en-4-one |
|---|---|
| PubChem CID | 114477853 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3-amino-2,7-dimethyloct-7-en-4-one |
| SMILES | C=C(C)CCC(=O)C(N)C(C)C |
| InChI | InChI=1S/C10H19NO/c1-7(2)5-6-9(12)10(11)8(3)4/h8,10H,1,5-6,11H2,2-4H3 |
| InChIKey | BYJXXTGQBYXTTB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|