C16H22N2 — CID 114480166
3-methyl-4-[[(1-methylcyclohexyl)amino]methyl]benzonitrile (PubChem CID 114480166) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 3-methyl-4-[[(1-methylcyclohexyl)amino]methyl]benzonitrile.
| Compound Name | 3-methyl-4-[[(1-methylcyclohexyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 114480166 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 3-methyl-4-[[(1-methylcyclohexyl)amino]methyl]benzonitrile |
| SMILES | Cc1cc(C#N)ccc1CNC1(C)CCCCC1 |
| InChI | InChI=1S/C16H22N2/c1-13-10-14(11-17)6-7-15(13)12-18-16(2)8-4-3-5-9-16/h6-7,10,18H,3-5,8-9,12H2,1-2H3 |
| InChIKey | ALXCBBDZNIVNQM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |