C17H20N2S2 — CID 114481875
3-methyl-4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]benzenecarbothioamide (PubChem CID 114481875) has the molecular formula C17H20N2S2 and a molecular weight of 316.50 g/mol. Its IUPAC name is 3-methyl-4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-methyl-4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 114481875 |
| Molecular Formula | C17H20N2S2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3-methyl-4-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]benzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)ccc1CN1CCc2sccc2C1C |
| InChI | InChI=1S/C17H20N2S2/c1-11-9-13(17(18)20)3-4-14(11)10-19-7-5-16-15(12(19)2)6-8-21-16/h3-4,6,8-9,12H,5,7,10H2,1-2H3,(H2,18,20) |
| InChIKey | QJFQRXKTLJPXHS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|